C22H20N4O2 — CID 18207037
4-[4-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitrobenzonitrile (PubChem CID 18207037) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[4-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitrobenzonitrile.
| Compound Name | 4-[4-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 18207037 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[4-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-3-nitrobenzonitrile |
| SMILES | CCc1cccc2c(C3=CCN(c4ccc(C#N)cc4[N+](=O)[O-])CC3)c[nH]c12 |
| InChI | InChI=1S/C22H20N4O2/c1-2-16-4-3-5-18-19(14-24-22(16)18)17-8-10-25(11-9-17)20-7-6-15(13-23)12-21(20)26(27)28/h3-8,12,14,24H,2,9-11H2,1H3 |
| InChIKey | XKKDODXICWNPOB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|