C15H11N5O2 — CID 18207172
(4-cyanophenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 18207172) has the molecular formula C15H11N5O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is (4-cyanophenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (4-cyanophenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 18207172 |
| Molecular Formula | C15H11N5O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (4-cyanophenyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(C)n2nc(C(=O)Oc3ccc(C#N)cc3)nc2n1 |
| InChI | InChI=1S/C15H11N5O2/c1-9-7-10(2)20-15(17-9)18-13(19-20)14(21)22-12-5-3-11(8-16)4-6-12/h3-7H,1-2H3 |
| InChIKey | OPLUHDJDBFRIOM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|