About N-(1-adamantylmethyl)-2,5-dichlorobenzamide
N-(1-adamantylmethyl)-2,5-dichlorobenzamide (PubChem CID 18209153) has the molecular formula C18H21Cl2NO
and a molecular weight of 338.28 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(1-adamantylmethyl)-2,5-dichlorobenzamide |
| PubChem CID | 18209153 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(1-adamantylmethyl)-2,5-dichlorobenzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H21Cl2NO/c19-14-1-2-16(20)15(6-14)17(22)21-10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2,(H,21,22) |
| InChIKey | MQAXGMKOSXBMHT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-adamantylmethyl)-2,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantylmethyl)-2,5-dichlorobenzamide?
The IUPAC name of N-(1-adamantylmethyl)-2,5-dichlorobenzamide (CID 18209153) is N-(1-adamantylmethyl)-2,5-dichlorobenzamide.
What is the SMILES notation for N-(1-adamantylmethyl)-2,5-dichlorobenzamide?
The canonical SMILES for N-(1-adamantylmethyl)-2,5-dichlorobenzamide is O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(Cl)ccc1Cl.
What is the InChIKey of N-(1-adamantylmethyl)-2,5-dichlorobenzamide?
The InChIKey is MQAXGMKOSXBMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2NO/c19-14-1-2-16(20)15(6-14)17(22)21-10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2,(H,21,22).
What are the key properties of N-(1-adamantylmethyl)-2,5-dichlorobenzamide?
N-(1-adamantylmethyl)-2,5-dichlorobenzamide has a molecular weight of 338.28 g/mol, XLogP of 4.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantylmethyl)-2,5-dichlorobenzamide is sourced from PubChem (CID 18209153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).