C26H34N2O3 — CID 18209297
N-butyl-N-ethyl-2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 18209297) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-butyl-N-ethyl-2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18209297 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-butyl-N-ethyl-2-(2-methoxyphenyl)-1-(4-methylphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CCCCN(CC)C(=O)C1CCC(=O)N(c2ccc(C)cc2)C1c1ccccc1OC |
| InChI | InChI=1S/C26H34N2O3/c1-5-7-18-27(6-2)26(30)22-16-17-24(29)28(20-14-12-19(3)13-15-20)25(22)21-10-8-9-11-23(21)31-4/h8-15,22,25H,5-7,16-18H2,1-4H3 |
| InChIKey | LJVIBIZHMGOQQH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |