C24H25N3O2S — CID 18209376
1-[4-ethyl-2-(4-methylphenyl)imino-1,3-thiazolidin-3-yl]-3-(5-phenyl-1,3-oxazol-2-yl)propan-1-one (PubChem CID 18209376) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-[4-ethyl-2-(4-methylphenyl)imino-1,3-thiazolidin-3-yl]-3-(5-phenyl-1,3-oxazol-2-yl)propan-1-one.
| Compound Name | 1-[4-ethyl-2-(4-methylphenyl)imino-1,3-thiazolidin-3-yl]-3-(5-phenyl-1,3-oxazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 18209376 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-[4-ethyl-2-(4-methylphenyl)imino-1,3-thiazolidin-3-yl]-3-(5-phenyl-1,3-oxazol-2-yl)propan-1-one |
| SMILES | CCC1CS/C(=N\c2ccc(C)cc2)N1C(=O)CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H25N3O2S/c1-3-20-16-30-24(26-19-11-9-17(2)10-12-19)27(20)23(28)14-13-22-25-15-21(29-22)18-7-5-4-6-8-18/h4-12,15,20H,3,13-14,16H2,1-2H3/b26-24- |
| InChIKey | VTVNUSCLSVRSLN-LCUIJRPUSA-N |
| XLogP | 5.62 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|