C39H48ClN3O5 — CID 18212304
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18212304) has the molecular formula C39H48ClN3O5 and a molecular weight of 674.28 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18212304 |
| Molecular Formula | C39H48ClN3O5 |
| Molecular Weight | 674.28 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2c(C)cccc2Cl)N(CCCCCCCC)C(=O)C(Cc2ccc(O)cc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C39H48ClN3O5/c1-7-9-10-11-12-13-25-43(37(46)33(41-38(47)48-39(4,5)6)26-29-19-23-31(44)24-20-29)35(30-21-17-28(8-2)18-22-30)36(45)42-34-27(3)15-14-16-32(34)40/h2,14-24,33,35,44H,7,9-13,25-26H2,1,3-6H3,(H,41,47)(H,42,45) |
| InChIKey | OGCICUUIGLGGRM-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.28 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|