C9H15N3O6 — CID 18218179
2-[(2,4-diamino-4-oxobutanoyl)amino]pentanedioic acid (PubChem CID 18218179) has the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. Its IUPAC name is 2-[(2,4-diamino-4-oxobutanoyl)amino]pentanedioic acid.
| Compound Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 18218179 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]pentanedioic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15N3O6/c10-4(3-6(11)13)8(16)12-5(9(17)18)1-2-7(14)15/h4-5H,1-3,10H2,(H2,11,13)(H,12,16)(H,14,15)(H,17,18) |
| InChIKey | IIFDPDVJAHQFSR-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |