C12H21N3O6S — CID 18218317
3-(2-aminopropanoylamino)-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid (PubChem CID 18218317) has the molecular formula C12H21N3O6S and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-(2-aminopropanoylamino)-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-(2-aminopropanoylamino)-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218317 |
| Molecular Formula | C12H21N3O6S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-(2-aminopropanoylamino)-4-[(1-carboxy-3-methylsulfanylpropyl)amino]-4-oxobutanoic acid |
| SMILES | CSCCC(NC(=O)C(CC(=O)O)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C12H21N3O6S/c1-6(13)10(18)15-8(5-9(16)17)11(19)14-7(12(20)21)3-4-22-2/h6-8H,3-5,13H2,1-2H3,(H,14,19)(H,15,18)(H,16,17)(H,20,21) |
| InChIKey | FOWHQTWRLFTELJ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |