C14H23N5O4 — CID 18218585
2-[[2-(2-aminopropanoylamino)-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18218585) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[[2-(2-aminopropanoylamino)-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-(2-aminopropanoylamino)-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18218585 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[[2-(2-aminopropanoylamino)-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NC(Cc1cnc[nH]1)C(=O)O)C(C)C |
| InChI | InChI=1S/C14H23N5O4/c1-7(2)11(19-12(20)8(3)15)13(21)18-10(14(22)23)4-9-5-16-6-17-9/h5-8,10-11H,4,15H2,1-3H3,(H,16,17)(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | CLOMBHBBUKAUBP-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |