C16H31N7O5 — CID 18218790
4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18218790) has the molecular formula C16H31N7O5 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18218790 |
| Molecular Formula | C16H31N7O5 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H31N7O5/c1-8(2)6-10(14(26)23-11(15(27)28)7-12(18)24)22-13(25)9(17)4-3-5-21-16(19)20/h8-11H,3-7,17H2,1-2H3,(H2,18,24)(H,22,25)(H,23,26)(H,27,28)(H4,19,20,21) |
| InChIKey | UHFUZWSZQKMDSX-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|