C13H20N6O5S — CID 18219054
2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18219054) has the molecular formula C13H20N6O5S and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18219054 |
| Molecular Formula | C13H20N6O5S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C13H20N6O5S/c14-7(2-10(15)20)11(21)19-9(4-25)12(22)18-8(13(23)24)1-6-3-16-5-17-6/h3,5,7-9,25H,1-2,4,14H2,(H2,15,20)(H,16,17)(H,18,22)(H,19,21)(H,23,24) |
| InChIKey | KGCUOPPQTPZILL-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 193.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|