C17H24N4O5S — CID 18220004
5-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18220004) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is 5-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18220004 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C17H24N4O5S/c18-11(9-27)15(23)21-13(8-10-4-2-1-3-5-10)16(24)20-12(17(25)26)6-7-14(19)22/h1-5,11-13,27H,6-9,18H2,(H2,19,22)(H,20,24)(H,21,23)(H,25,26) |
| InChIKey | BBQIWFFTTQTNOC-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|