C12H23N3O5S — CID 18220129
2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18220129) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18220129 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CS)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C12H23N3O5S/c1-5(2)8(14-10(17)7(13)4-21)11(18)15-9(6(3)16)12(19)20/h5-9,16,21H,4,13H2,1-3H3,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | FNXOZWPPOJRBRE-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|