C12H23N3O5 — CID 18221153
2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18221153) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18221153 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)CN)C(C)O)C(=O)O |
| InChI | InChI=1S/C12H23N3O5/c1-6(2)4-8(12(19)20)14-11(18)10(7(3)16)15-9(17)5-13/h6-8,10,16H,4-5,13H2,1-3H3,(H,14,18)(H,15,17)(H,19,20) |
| InChIKey | ZZWUYQXMIFTIIY-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |