C16H27N3O6 — CID 18221870
2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 18221870) has the molecular formula C16H27N3O6 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18221870 |
| Molecular Formula | C16H27N3O6 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O6/c1-3-9(2)13(17)15(23)19-8-4-5-11(19)14(22)18-10(16(24)25)6-7-12(20)21/h9-11,13H,3-8,17H2,1-2H3,(H,18,22)(H,20,21)(H,24,25) |
| InChIKey | AXFMEGAFCUULFV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |