C14H25N3O6 — CID 18221982
2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]pentanedioic acid (PubChem CID 18221982) has the molecular formula C14H25N3O6 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18221982 |
| Molecular Formula | C14H25N3O6 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[2-[(2-amino-4-methylpentanoyl)amino]propanoylamino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N3O6/c1-7(2)6-9(15)13(21)16-8(3)12(20)17-10(14(22)23)4-5-11(18)19/h7-10H,4-6,15H2,1-3H3,(H,16,21)(H,17,20)(H,18,19)(H,22,23) |
| InChIKey | CQQGCWPXDHTTNF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |