C15H27N3O6S — CID 18222872
2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylpentanoyl]amino]butanedioic acid (PubChem CID 18222872) has the molecular formula C15H27N3O6S and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylpentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylpentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18222872 |
| Molecular Formula | C15H27N3O6S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylpentanoyl]amino]butanedioic acid |
| SMILES | CSCCC(N)C(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27N3O6S/c1-8(2)6-10(17-13(21)9(16)4-5-25-3)14(22)18-11(15(23)24)7-12(19)20/h8-11H,4-7,16H2,1-3H3,(H,17,21)(H,18,22)(H,19,20)(H,23,24) |
| InChIKey | UROWNMBTQGGTHB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |