C15H27N3O4S — CID 18223655
3-methyl-2-[[4-methylsulfanyl-2-(pyrrolidine-2-carbonylamino)butanoyl]amino]butanoic acid (PubChem CID 18223655) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-methyl-2-[[4-methylsulfanyl-2-(pyrrolidine-2-carbonylamino)butanoyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-methylsulfanyl-2-(pyrrolidine-2-carbonylamino)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 18223655 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-methyl-2-[[4-methylsulfanyl-2-(pyrrolidine-2-carbonylamino)butanoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)C1CCCN1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C15H27N3O4S/c1-9(2)12(15(21)22)18-14(20)11(6-8-23-3)17-13(19)10-5-4-7-16-10/h9-12,16H,4-8H2,1-3H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | AUYKOPJPKUCYHE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |