C11H20N4O6 — CID 18223791
5-amino-2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-5-oxopentanoic acid (PubChem CID 18223791) has the molecular formula C11H20N4O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 5-amino-2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18223791 |
| Molecular Formula | C11H20N4O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-amino-2-[2-[(2-amino-3-hydroxypropanoyl)amino]propanoylamino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CO)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H20N4O6/c1-5(14-10(19)6(12)4-16)9(18)15-7(11(20)21)2-3-8(13)17/h5-7,16H,2-4,12H2,1H3,(H2,13,17)(H,14,19)(H,15,18)(H,20,21) |
| InChIKey | MMGJPDWSIOAGTH-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |