C17H25N3O5 — CID 18224165
2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18224165) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18224165 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25N3O5/c1-10(2)14(20-15(22)12(18)9-21)16(23)19-13(17(24)25)8-11-6-4-3-5-7-11/h3-7,10,12-14,21H,8-9,18H2,1-2H3,(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | HNDMFDBQXYZSRM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |