C16H31N3O5 — CID 18224375
2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid (PubChem CID 18224375) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18224375 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CC(C)C)NC(=O)C(N)C(C)O)C(=O)O |
| InChI | InChI=1S/C16H31N3O5/c1-8(2)6-11(18-15(22)13(17)10(5)20)14(21)19-12(16(23)24)7-9(3)4/h8-13,20H,6-7,17H2,1-5H3,(H,18,22)(H,19,21)(H,23,24) |
| InChIKey | MEJHFIOYJHTWMK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |