C13H23N3O7S — CID 18224406
2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid (PubChem CID 18224406) has the molecular formula C13H23N3O7S and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18224406 |
| Molecular Formula | C13H23N3O7S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
| SMILES | CSCCC(NC(=O)C(N)C(C)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O7S/c1-6(17)10(14)12(21)15-7(3-4-24-2)11(20)16-8(13(22)23)5-9(18)19/h6-8,10,17H,3-5,14H2,1-2H3,(H,15,21)(H,16,20)(H,18,19)(H,22,23) |
| InChIKey | YJVJPJPHHFOVMG-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |