C20H15Cl2N3O4 — CID 18225512
[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 18225512) has the molecular formula C20H15Cl2N3O4 and a molecular weight of 432.26 g/mol. Its IUPAC name is [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18225512 |
| Molecular Formula | C20H15Cl2N3O4 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | NC(=O)Cn1c(COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H15Cl2N3O4/c21-14-7-5-12(9-15(14)22)6-8-19(27)29-11-18-24-16-4-2-1-3-13(16)20(28)25(18)10-17(23)26/h1-9H,10-11H2,(H2,23,26)/b8-6+ |
| InChIKey | FVQGDCRTWBMXHI-SOFGYWHQSA-N |
| XLogP | 2.95 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|