About 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate
1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 18227988) has the molecular formula C19H15FN2O4S2
and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| PubChem CID | 18227988 |
| Molecular Formula | C19H15FN2O4S2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OC(C)c3ccc(F)cc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H15FN2O4S2/c1-11-10-27-19(21-11)28-17-8-5-14(9-16(17)22(24)25)18(23)26-12(2)13-3-6-15(20)7-4-13/h3-10,12H,1-2H3 |
| InChIKey | GGJPFRIKAGBBPV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate?
The IUPAC name of 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (CID 18227988) is 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
What is the SMILES notation for 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate?
The canonical SMILES for 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate is Cc1csc(Sc2ccc(C(=O)OC(C)c3ccc(F)cc3)cc2[N+](=O)[O-])n1.
What is the InChIKey of 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate?
The InChIKey is GGJPFRIKAGBBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN2O4S2/c1-11-10-27-19(21-11)28-17-8-5-14(9-16(17)22(24)25)18(23)26-12(2)13-3-6-15(20)7-4-13/h3-10,12H,1-2H3.
What are the key properties of 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate?
1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate has a molecular weight of 418.47 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)ethyl 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate is sourced from PubChem (CID 18227988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).