C15H20FN7 — CID 18229128
4-N,6-N-diethyl-2-N-[(E)-1-(3-fluorophenyl)ethylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 18229128) has the molecular formula C15H20FN7 and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-N,6-N-diethyl-2-N-[(E)-1-(3-fluorophenyl)ethylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diethyl-2-N-[(E)-1-(3-fluorophenyl)ethylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18229128 |
| Molecular Formula | C15H20FN7 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 4-N,6-N-diethyl-2-N-[(E)-1-(3-fluorophenyl)ethylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC)nc(N/N=C(\C)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H20FN7/c1-4-17-13-19-14(18-5-2)21-15(20-13)23-22-10(3)11-7-6-8-12(16)9-11/h6-9H,4-5H2,1-3H3,(H3,17,18,19,20,21,23)/b22-10+ |
| InChIKey | ULPCBNGUSKJHEZ-LSHDLFTRSA-N |
| XLogP | 2.71 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|