C20H22N4O5S — CID 18230237
2-(2-nitrophenyl)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide (PubChem CID 18230237) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18230237 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C20H22N4O5S/c25-20(13-15-7-3-4-10-18(15)24(26)27)22-16-8-6-9-17(14-16)30(28,29)23-19-11-2-1-5-12-21-19/h3-4,6-10,14H,1-2,5,11-13H2,(H,21,23)(H,22,25) |
| InChIKey | FFEBEGICLUPYBF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|