About N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide (PubChem CID 18230751) has the molecular formula C21H29ClN4O4
and a molecular weight of 436.94 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide.
Molecular Properties
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide |
| PubChem CID | 18230751 |
| Molecular Formula | C21H29ClN4O4 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide |
| SMILES | CCCCN(C(=O)C(C)Oc1ccc(Cl)cc1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H29ClN4O4/c1-4-6-12-25(20(28)14(3)30-16-10-8-15(22)9-11-16)17-18(23)26(13-7-5-2)21(29)24-19(17)27/h8-11,14H,4-7,12-13,23H2,1-3H3,(H,24,27,29) |
| InChIKey | MQIHIDKNWNLXAB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide?
The IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide (CID 18230751) is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide.
What is the SMILES notation for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide?
The canonical SMILES for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide is CCCCN(C(=O)C(C)Oc1ccc(Cl)cc1)c1c(N)n(CCCC)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide?
The InChIKey is MQIHIDKNWNLXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29ClN4O4/c1-4-6-12-25(20(28)14(3)30-16-10-8-15(22)9-11-16)17-18(23)26(13-7-5-2)21(29)24-19(17)27/h8-11,14H,4-7,12-13,23H2,1-3H3,(H,24,27,29).
What are the key properties of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide?
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide has a molecular weight of 436.94 g/mol, XLogP of 3.17, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-2-(4-chlorophenoxy)propanamide is sourced from PubChem (CID 18230751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).