C16H18ClN3O2S3 — CID 18230753
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 18230753) has the molecular formula C16H18ClN3O2S3 and a molecular weight of 415.99 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 18230753 |
| Molecular Formula | C16H18ClN3O2S3 |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CC(Sc1nn(-c2ccc(Cl)cc2)c(=S)s1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C16H18ClN3O2S3/c1-10(14(21)18-9-13-3-2-8-22-13)24-15-19-20(16(23)25-15)12-6-4-11(17)5-7-12/h4-7,10,13H,2-3,8-9H2,1H3,(H,18,21) |
| InChIKey | XDNQLDSRQORBNM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|