About (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 18231505) has the molecular formula C21H16ClN3O3S
and a molecular weight of 425.90 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 18231505 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCc1ccc(-c2nc(C(=O)OCc3cc(=O)n4cc(Cl)ccc4n3)cs2)cc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c1-2-13-3-5-14(6-4-13)20-24-17(12-29-20)21(27)28-11-16-9-19(26)25-10-15(22)7-8-18(25)23-16/h3-10,12H,2,11H2,1H3 |
| InChIKey | JSBAQWVOJDVMLQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate (CID 18231505) is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate is CCc1ccc(-c2nc(C(=O)OCc3cc(=O)n4cc(Cl)ccc4n3)cs2)cc1.
What is the InChIKey of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is JSBAQWVOJDVMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN3O3S/c1-2-13-3-5-14(6-4-13)20-24-17(12-29-20)21(27)28-11-16-9-19(26)25-10-15(22)7-8-18(25)23-16/h3-10,12H,2,11H2,1H3.
What are the key properties of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate?
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 425.90 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 18231505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).