C15H29N3O5 — CID 18232401
2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18232401) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18232401 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)C(C)C)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C15H29N3O5/c1-6-8(4)11(17-13(20)10(16)7(2)3)14(21)18-12(9(5)19)15(22)23/h7-12,19H,6,16H2,1-5H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | APQIVBCUIUDSMB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |