C17H33N3O4 — CID 18232413
2-[[2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18232413) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18232413 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(N)C(C)C)C(=O)O |
| InChI | InChI=1S/C17H33N3O4/c1-7-11(6)14(17(23)24)20-15(21)12(8-9(2)3)19-16(22)13(18)10(4)5/h9-14H,7-8,18H2,1-6H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | DAVNYIUELQBTAP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |