C14H26N4O5 — CID 18232769
2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-methylpentanoyl]amino]acetic acid (PubChem CID 18232769) has the molecular formula C14H26N4O5 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18232769 |
| Molecular Formula | C14H26N4O5 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[[2-[2-(2-aminopropanoylamino)propanoylamino]-3-methylpentanoyl]amino]acetic acid |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)C(C)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H26N4O5/c1-5-7(2)11(14(23)16-6-10(19)20)18-13(22)9(4)17-12(21)8(3)15/h7-9,11H,5-6,15H2,1-4H3,(H,16,23)(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | YBSFDKKZYDYONJ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |