C23H37N5O5S — CID 18237211
2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18237211) has the molecular formula C23H37N5O5S and a molecular weight of 495.65 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18237211 |
| Molecular Formula | C23H37N5O5S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCCN)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C23H37N5O5S/c1-15(25)20(29)26-17(10-6-7-12-24)21(30)28-19(14-16-8-4-3-5-9-16)22(31)27-18(23(32)33)11-13-34-2/h3-5,8-9,15,17-19H,6-7,10-14,24-25H2,1-2H3,(H,26,29)(H,27,31)(H,28,30)(H,32,33) |
| InChIKey | XNFKTGWEJAAEIF-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|