C19H33N5O5 — CID 18237232
1-[1-[6-amino-2-(2-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 18237232) has the molecular formula C19H33N5O5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[1-[6-amino-2-(2-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[1-[6-amino-2-(2-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18237232 |
| Molecular Formula | C19H33N5O5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-[1-[6-amino-2-(2-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(N)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C19H33N5O5/c1-12(21)16(25)22-13(6-2-3-9-20)17(26)23-10-4-7-14(23)18(27)24-11-5-8-15(24)19(28)29/h12-15H,2-11,20-21H2,1H3,(H,22,25)(H,28,29) |
| InChIKey | LVCNQTJBNXTGNL-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|