C20H28N4O5S — CID 18238224
2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18238224) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18238224 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(N)C(=O)N1CCCC1C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H28N4O5S/c1-12(21)19(27)24-9-5-8-16(24)18(26)23-15(11-30)17(25)22-14(20(28)29)10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16,30H,5,8-11,21H2,1H3,(H,22,25)(H,23,26)(H,28,29) |
| InChIKey | NAKHVFGXRNRNKU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|