About 5-hydroxydecanoate
5-hydroxydecanoate (PubChem CID 1824) has the molecular formula C10H19O3-
and a molecular weight of 187.26 g/mol. Its IUPAC name is 5-hydroxydecanoate.
Molecular Properties
| Compound Name | 5-hydroxydecanoate |
| PubChem CID | 1824 |
| Molecular Formula | C10H19O3- |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 5-hydroxydecanoate |
| SMILES | CCCCCC(O)CCCC(=O)[O-] |
| InChI | InChI=1S/C10H20O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/p-1 |
| InChIKey | LMHJFKYQYDSOQO-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxydecanoate?
The IUPAC name of 5-hydroxydecanoate (CID 1824) is 5-hydroxydecanoate.
What is the SMILES notation for 5-hydroxydecanoate?
The canonical SMILES for 5-hydroxydecanoate is CCCCCC(O)CCCC(=O)[O-].
What is the InChIKey of 5-hydroxydecanoate?
The InChIKey is LMHJFKYQYDSOQO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/p-1.
What are the key properties of 5-hydroxydecanoate?
5-hydroxydecanoate has a molecular weight of 187.26 g/mol, XLogP of 0.85, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxydecanoate is sourced from PubChem (CID 1824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).