C16H29N7O7 — CID 18240524
2-[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]propanoylamino]butanedioic acid (PubChem CID 18240524) has the molecular formula C16H29N7O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]propanoylamino]butanedioic acid.
| Compound Name | 2-[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 18240524 |
| Molecular Formula | C16H29N7O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]propanoylamino]butanedioic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N7O7/c1-7(22-14(28)9(17)4-3-5-20-16(18)19)12(26)21-8(2)13(27)23-10(15(29)30)6-11(24)25/h7-10H,3-6,17H2,1-2H3,(H,21,26)(H,22,28)(H,23,27)(H,24,25)(H,29,30)(H4,18,19,20) |
| InChIKey | GVSWYDCZXDZEGN-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|