C23H38N10O6 — CID 18241073
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18241073) has the molecular formula C23H38N10O6 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18241073 |
| Molecular Formula | C23H38N10O6 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H38N10O6/c24-15(3-1-9-29-22(25)26)19(36)33-16(4-2-10-30-23(27)28)20(37)31-12-18(35)32-17(21(38)39)11-13-5-7-14(34)8-6-13/h5-8,15-17,34H,1-4,9-12,24H2,(H,31,37)(H,32,35)(H,33,36)(H,38,39)(H4,25,26,29)(H4,27,28,30) |
| InChIKey | LORUKOBEXIGLKV-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|