C24H45N13O5 — CID 18241143
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18241143) has the molecular formula C24H45N13O5 and a molecular weight of 595.71 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18241143 |
| Molecular Formula | C24H45N13O5 |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.37 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H45N13O5/c25-8-2-1-6-16(21(40)37-18(22(41)42)11-14-12-31-13-34-14)36-20(39)17(7-4-10-33-24(29)30)35-19(38)15(26)5-3-9-32-23(27)28/h12-13,15-18H,1-11,25-26H2,(H,31,34)(H,35,38)(H,36,39)(H,37,40)(H,41,42)(H4,27,28,32)(H4,29,30,33) |
| InChIKey | UFULPVPVKAEIDD-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 334.12 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|