C23H45N11O6 — CID 18244118
5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18244118) has the molecular formula C23H45N11O6 and a molecular weight of 571.68 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18244118 |
| Molecular Formula | C23H45N11O6 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H45N11O6/c1-3-12(2)17(34-18(36)13(24)6-4-10-30-22(26)27)20(38)32-14(7-5-11-31-23(28)29)19(37)33-15(21(39)40)8-9-16(25)35/h12-15,17H,3-11,24H2,1-2H3,(H2,25,35)(H,32,38)(H,33,37)(H,34,36)(H,39,40)(H4,26,27,30)(H4,28,29,31) |
| InChIKey | NUMPZYHVRDGOQP-UHFFFAOYSA-N |
| XLogP | -3.73 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|