C23H32N4O9 — CID 18247970
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 18247970) has the molecular formula C23H32N4O9 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18247970 |
| Molecular Formula | C23H32N4O9 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CC(=O)O)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H32N4O9/c1-3-12(2)19(23(35)36)27-22(34)15(9-13-7-5-4-6-8-13)26-21(33)16(11-18(30)31)25-20(32)14(24)10-17(28)29/h4-8,12,14-16,19H,3,9-11,24H2,1-2H3,(H,25,32)(H,26,33)(H,27,34)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | TWXYDTOPXYRABI-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |