C24H33N5O7S — CID 18248317
3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18248317) has the molecular formula C24H33N5O7S and a molecular weight of 535.62 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18248317 |
| Molecular Formula | C24H33N5O7S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 3-amino-4-[[1-[[1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CS)NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H33N5O7S/c1-12(2)7-17(27-23(34)19(11-37)29-21(32)15(25)9-20(30)31)22(33)28-18(24(35)36)8-13-10-26-16-6-4-3-5-14(13)16/h3-6,10,12,15,17-19,26,37H,7-9,11,25H2,1-2H3,(H,27,34)(H,28,33)(H,29,32)(H,30,31)(H,35,36) |
| InChIKey | DZPXGXGAKCWCNW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|