C17H26N6O7 — CID 18249476
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18249476) has the molecular formula C17H26N6O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18249476 |
| Molecular Formula | C17H26N6O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)CNC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H26N6O7/c1-8(2)14(17(29)30)23-16(28)11(3-9-5-19-7-21-9)22-12(24)6-20-15(27)10(18)4-13(25)26/h5,7-8,10-11,14H,3-4,6,18H2,1-2H3,(H,19,21)(H,20,27)(H,22,24)(H,23,28)(H,25,26)(H,29,30) |
| InChIKey | JMSNOPZDZBCSMG-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 216.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |