C27H35N7O7 — CID 18253458
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18253458) has the molecular formula C27H35N7O7 and a molecular weight of 569.62 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18253458 |
| Molecular Formula | C27H35N7O7 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H35N7O7/c1-3-14(2)23(27(40)41)34-26(39)21(9-16-12-29-13-31-16)33-25(38)20(32-24(37)18(28)10-22(35)36)8-15-11-30-19-7-5-4-6-17(15)19/h4-7,11-14,18,20-21,23,30H,3,8-10,28H2,1-2H3,(H,29,31)(H,32,37)(H,33,38)(H,34,39)(H,35,36)(H,40,41) |
| InChIKey | BBAIDEOTWQRZRZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 232.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |