C29H35N5O8 — CID 18254045
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18254045) has the molecular formula C29H35N5O8 and a molecular weight of 581.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18254045 |
| Molecular Formula | C29H35N5O8 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H35N5O8/c1-15(2)25(29(41)42)34-28(40)23(12-17-14-31-21-6-4-3-5-19(17)21)33-27(39)22(11-16-7-9-18(35)10-8-16)32-26(38)20(30)13-24(36)37/h3-10,14-15,20,22-23,25,31,35H,11-13,30H2,1-2H3,(H,32,38)(H,33,39)(H,34,40)(H,36,37)(H,41,42) |
| InChIKey | YYZLZNCFQKXGQD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |