C17H24N4O5S — CID 18254638
2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 18254638) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18254638 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N4O5S/c1-10(20-16(24)12(18)9-27)15(23)19-8-14(22)21-13(17(25)26)7-11-5-3-2-4-6-11/h2-6,10,12-13,27H,7-9,18H2,1H3,(H,19,23)(H,20,24)(H,21,22)(H,25,26) |
| InChIKey | SPYVGYHBMFEEDK-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|