C22H30N4O7S — CID 18259957
2-[[1-[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 18259957) has the molecular formula C22H30N4O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[[1-[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18259957 |
| Molecular Formula | C22H30N4O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[[1-[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | NC(CS)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H30N4O7S/c23-14(12-34)19(29)25-16(11-13-5-2-1-3-6-13)21(31)26-10-4-7-17(26)20(30)24-15(22(32)33)8-9-18(27)28/h1-3,5-6,14-17,34H,4,7-12,23H2,(H,24,30)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | WDWTZFCMEDEWGG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|