C25H33N7O5S2 — CID 18261442
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18261442) has the molecular formula C25H33N7O5S2 and a molecular weight of 575.72 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18261442 |
| Molecular Formula | C25H33N7O5S2 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C25H33N7O5S2/c1-39-7-6-19(25(36)37)30-24(35)21(9-15-11-27-13-29-15)32-23(34)20(31-22(33)17(26)12-38)8-14-10-28-18-5-3-2-4-16(14)18/h2-5,10-11,13,17,19-21,28,38H,6-9,12,26H2,1H3,(H,27,29)(H,30,35)(H,31,33)(H,32,34)(H,36,37) |
| InChIKey | ADKDDLVEEQZUCO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 195.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|