C22H30N4O10 — CID 18262819
2-[[2-[2-[(2-amino-4-carboxybutanoyl)amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid (PubChem CID 18262819) has the molecular formula C22H30N4O10 and a molecular weight of 510.50 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-4-carboxybutanoyl)amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[2-[(2-amino-4-carboxybutanoyl)amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18262819 |
| Molecular Formula | C22H30N4O10 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2-[[2-[2-[(2-amino-4-carboxybutanoyl)amino]propanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H30N4O10/c1-11(24-20(33)14(23)6-8-17(28)29)19(32)26-16(10-12-2-4-13(27)5-3-12)21(34)25-15(22(35)36)7-9-18(30)31/h2-5,11,14-16,27H,6-10,23H2,1H3,(H,24,33)(H,25,34)(H,26,32)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | XRBSDDCVKADTOI-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 245.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |