C20H37N5O7S — CID 18264276
2-[[6-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid (PubChem CID 18264276) has the molecular formula C20H37N5O7S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18264276 |
| Molecular Formula | C20H37N5O7S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(CS)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H37N5O7S/c1-3-11(2)16(20(31)32)25-18(29)13(6-4-5-9-21)23-19(30)14(10-33)24-17(28)12(22)7-8-15(26)27/h11-14,16,33H,3-10,21-22H2,1-2H3,(H,23,30)(H,24,28)(H,25,29)(H,26,27)(H,31,32) |
| InChIKey | USBYNUCYCGGBLB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|